C12H26N2O3 — CID 64694411
4-amino-2-[2-methoxyethyl(pentan-3-yl)amino]butanoic acid (PubChem CID 64694411) has the molecular formula C12H26N2O3 and a molecular weight of 246.35 g/mol. Its IUPAC name is 4-amino-2-[2-methoxyethyl(pentan-3-yl)amino]butanoic acid.
| Compound Name | 4-amino-2-[2-methoxyethyl(pentan-3-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 64694411 |
| Molecular Formula | C12H26N2O3 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | 4-amino-2-[2-methoxyethyl(pentan-3-yl)amino]butanoic acid |
| SMILES | CCC(CC)N(CCOC)C(CCN)C(=O)O |
| InChI | InChI=1S/C12H26N2O3/c1-4-10(5-2)14(8-9-17-3)11(6-7-13)12(15)16/h10-11H,4-9,13H2,1-3H3,(H,15,16) |
| InChIKey | CZSFMVRIIXKENT-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |