C16H22N2O2 — CID 6469518
3,5-dimethyl-N-(1,2-oxazol-3-yl)adamantane-1-carboxamide (PubChem CID 6469518) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 3,5-dimethyl-N-(1,2-oxazol-3-yl)adamantane-1-carboxamide.
| Compound Name | 3,5-dimethyl-N-(1,2-oxazol-3-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 6469518 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 3,5-dimethyl-N-(1,2-oxazol-3-yl)adamantane-1-carboxamide |
| SMILES | CC12CC3CC(C)(C1)CC(C(=O)Nc1ccon1)(C3)C2 |
| InChI | InChI=1S/C16H22N2O2/c1-14-5-11-6-15(2,8-14)10-16(7-11,9-14)13(19)17-12-3-4-20-18-12/h3-4,11H,5-10H2,1-2H3,(H,17,18,19) |
| InChIKey | DPSKPDWNYGBYAE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |