About 6,8-ditert-butyl-2,2-dimethyl-3H-chromen-4-one
6,8-ditert-butyl-2,2-dimethyl-3H-chromen-4-one (PubChem CID 64697677) has the molecular formula C19H28O2
and a molecular weight of 288.43 g/mol. Its IUPAC name is 6,8-ditert-butyl-2,2-dimethyl-3H-chromen-4-one.
Molecular Properties
| Compound Name | 6,8-ditert-butyl-2,2-dimethyl-3H-chromen-4-one |
| PubChem CID | 64697677 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 6,8-ditert-butyl-2,2-dimethyl-3H-chromen-4-one |
| SMILES | CC1(C)CC(=O)c2cc(C(C)(C)C)cc(C(C)(C)C)c2O1 |
| InChI | InChI=1S/C19H28O2/c1-17(2,3)12-9-13-15(20)11-19(7,8)21-16(13)14(10-12)18(4,5)6/h9-10H,11H2,1-8H3 |
| InChIKey | ZLEPRTPCIXIMTI-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,8-ditert-butyl-2,2-dimethyl-3H-chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-ditert-butyl-2,2-dimethyl-3H-chromen-4-one?
The IUPAC name of 6,8-ditert-butyl-2,2-dimethyl-3H-chromen-4-one (CID 64697677) is 6,8-ditert-butyl-2,2-dimethyl-3H-chromen-4-one.
What is the SMILES notation for 6,8-ditert-butyl-2,2-dimethyl-3H-chromen-4-one?
The canonical SMILES for 6,8-ditert-butyl-2,2-dimethyl-3H-chromen-4-one is CC1(C)CC(=O)c2cc(C(C)(C)C)cc(C(C)(C)C)c2O1.
What is the InChIKey of 6,8-ditert-butyl-2,2-dimethyl-3H-chromen-4-one?
The InChIKey is ZLEPRTPCIXIMTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28O2/c1-17(2,3)12-9-13-15(20)11-19(7,8)21-16(13)14(10-12)18(4,5)6/h9-10H,11H2,1-8H3.
What are the key properties of 6,8-ditert-butyl-2,2-dimethyl-3H-chromen-4-one?
6,8-ditert-butyl-2,2-dimethyl-3H-chromen-4-one has a molecular weight of 288.43 g/mol, XLogP of 5.03, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-ditert-butyl-2,2-dimethyl-3H-chromen-4-one is sourced from PubChem (CID 64697677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).