About 3-(cyclopentylmethylsulfonyl)-4,4,4-trifluorobutan-1-amine
3-(cyclopentylmethylsulfonyl)-4,4,4-trifluorobutan-1-amine (PubChem CID 64697882) has the molecular formula C10H18F3NO2S
and a molecular weight of 273.32 g/mol. Its IUPAC name is 3-(cyclopentylmethylsulfonyl)-4,4,4-trifluorobutan-1-amine.
Molecular Properties
| Compound Name | 3-(cyclopentylmethylsulfonyl)-4,4,4-trifluorobutan-1-amine |
| PubChem CID | 64697882 |
| Molecular Formula | C10H18F3NO2S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 3-(cyclopentylmethylsulfonyl)-4,4,4-trifluorobutan-1-amine |
| SMILES | NCCC(C(F)(F)F)S(=O)(=O)CC1CCCC1 |
| InChI | InChI=1S/C10H18F3NO2S/c11-10(12,13)9(5-6-14)17(15,16)7-8-3-1-2-4-8/h8-9H,1-7,14H2 |
| InChIKey | SLSCTJOCQWHJGT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(cyclopentylmethylsulfonyl)-4,4,4-trifluorobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclopentylmethylsulfonyl)-4,4,4-trifluorobutan-1-amine?
The IUPAC name of 3-(cyclopentylmethylsulfonyl)-4,4,4-trifluorobutan-1-amine (CID 64697882) is 3-(cyclopentylmethylsulfonyl)-4,4,4-trifluorobutan-1-amine.
What is the SMILES notation for 3-(cyclopentylmethylsulfonyl)-4,4,4-trifluorobutan-1-amine?
The canonical SMILES for 3-(cyclopentylmethylsulfonyl)-4,4,4-trifluorobutan-1-amine is NCCC(C(F)(F)F)S(=O)(=O)CC1CCCC1.
What is the InChIKey of 3-(cyclopentylmethylsulfonyl)-4,4,4-trifluorobutan-1-amine?
The InChIKey is SLSCTJOCQWHJGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F3NO2S/c11-10(12,13)9(5-6-14)17(15,16)7-8-3-1-2-4-8/h8-9H,1-7,14H2.
What are the key properties of 3-(cyclopentylmethylsulfonyl)-4,4,4-trifluorobutan-1-amine?
3-(cyclopentylmethylsulfonyl)-4,4,4-trifluorobutan-1-amine has a molecular weight of 273.32 g/mol, XLogP of 1.87, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclopentylmethylsulfonyl)-4,4,4-trifluorobutan-1-amine is sourced from PubChem (CID 64697882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).