About 3-cyclopentylsulfonyl-4,4,4-trifluorobutan-1-amine
3-cyclopentylsulfonyl-4,4,4-trifluorobutan-1-amine (PubChem CID 64698077) has the molecular formula C9H16F3NO2S
and a molecular weight of 259.29 g/mol. Its IUPAC name is 3-cyclopentylsulfonyl-4,4,4-trifluorobutan-1-amine.
Molecular Properties
| Compound Name | 3-cyclopentylsulfonyl-4,4,4-trifluorobutan-1-amine |
| PubChem CID | 64698077 |
| Molecular Formula | C9H16F3NO2S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 3-cyclopentylsulfonyl-4,4,4-trifluorobutan-1-amine |
| SMILES | NCCC(C(F)(F)F)S(=O)(=O)C1CCCC1 |
| InChI | InChI=1S/C9H16F3NO2S/c10-9(11,12)8(5-6-13)16(14,15)7-3-1-2-4-7/h7-8H,1-6,13H2 |
| InChIKey | QHMXQPFTZJEEPA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclopentylsulfonyl-4,4,4-trifluorobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentylsulfonyl-4,4,4-trifluorobutan-1-amine?
The IUPAC name of 3-cyclopentylsulfonyl-4,4,4-trifluorobutan-1-amine (CID 64698077) is 3-cyclopentylsulfonyl-4,4,4-trifluorobutan-1-amine.
What is the SMILES notation for 3-cyclopentylsulfonyl-4,4,4-trifluorobutan-1-amine?
The canonical SMILES for 3-cyclopentylsulfonyl-4,4,4-trifluorobutan-1-amine is NCCC(C(F)(F)F)S(=O)(=O)C1CCCC1.
What is the InChIKey of 3-cyclopentylsulfonyl-4,4,4-trifluorobutan-1-amine?
The InChIKey is QHMXQPFTZJEEPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NO2S/c10-9(11,12)8(5-6-13)16(14,15)7-3-1-2-4-7/h7-8H,1-6,13H2.
What are the key properties of 3-cyclopentylsulfonyl-4,4,4-trifluorobutan-1-amine?
3-cyclopentylsulfonyl-4,4,4-trifluorobutan-1-amine has a molecular weight of 259.29 g/mol, XLogP of 1.62, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentylsulfonyl-4,4,4-trifluorobutan-1-amine is sourced from PubChem (CID 64698077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).