About [1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidin-4-yl]-(4-methoxyphenyl)methanone
[1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidin-4-yl]-(4-methoxyphenyl)methanone (PubChem CID 646983) has the molecular formula C21H23NO6S
and a molecular weight of 417.48 g/mol. Its IUPAC name is [1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidin-4-yl]-(4-methoxyphenyl)methanone.
Molecular Properties
| Compound Name | [1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidin-4-yl]-(4-methoxyphenyl)methanone |
| PubChem CID | 646983 |
| Molecular Formula | C21H23NO6S |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | [1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidin-4-yl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)C2CCN(S(=O)(=O)c3ccc4c(c3)OCCO4)CC2)cc1 |
| InChI | InChI=1S/C21H23NO6S/c1-26-17-4-2-15(3-5-17)21(23)16-8-10-22(11-9-16)29(24,25)18-6-7-19-20(14-18)28-13-12-27-19/h2-7,14,16H,8-13H2,1H3 |
| InChIKey | LARZJWOLUMSEIB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidin-4-yl]-(4-methoxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidin-4-yl]-(4-methoxyphenyl)methanone?
The IUPAC name of [1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidin-4-yl]-(4-methoxyphenyl)methanone (CID 646983) is [1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidin-4-yl]-(4-methoxyphenyl)methanone.
What is the SMILES notation for [1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidin-4-yl]-(4-methoxyphenyl)methanone?
The canonical SMILES for [1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidin-4-yl]-(4-methoxyphenyl)methanone is COc1ccc(C(=O)C2CCN(S(=O)(=O)c3ccc4c(c3)OCCO4)CC2)cc1.
What is the InChIKey of [1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidin-4-yl]-(4-methoxyphenyl)methanone?
The InChIKey is LARZJWOLUMSEIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO6S/c1-26-17-4-2-15(3-5-17)21(23)16-8-10-22(11-9-16)29(24,25)18-6-7-19-20(14-18)28-13-12-27-19/h2-7,14,16H,8-13H2,1H3.
What are the key properties of [1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidin-4-yl]-(4-methoxyphenyl)methanone?
[1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidin-4-yl]-(4-methoxyphenyl)methanone has a molecular weight of 417.48 g/mol, XLogP of 2.75, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidin-4-yl]-(4-methoxyphenyl)methanone is sourced from PubChem (CID 646983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).