methyl 4-[(4-chloropyrazol-1-yl)methyl]benzoate

C12H11ClN2O2 — CID 646984

IUPACmethyl 4-[(4-chloropyrazol-1-yl)methyl]benzoate
SMILESCOC(=O)c1ccc(Cn2cc(Cl)cn2)cc1
InChIInChI=1S/C12H11ClN2O2/c1-17-12(16)10-4-2-9(3-5-10)7-15-8-11(13)6-14-15/h2-6,8H,7H2,1H3
InChIKeyRSGAWEZPVHSTLH-UHFFFAOYSA-N
MW250.69 g/mol
LogP2.37
Rot. Bonds3

About methyl 4-[(4-chloropyrazol-1-yl)methyl]benzoate

methyl 4-[(4-chloropyrazol-1-yl)methyl]benzoate (PubChem CID 646984) has the molecular formula C12H11ClN2O2 and a molecular weight of 250.69 g/mol. Its IUPAC name is methyl 4-[(4-chloropyrazol-1-yl)methyl]benzoate.

Molecular Properties

Compound Namemethyl 4-[(4-chloropyrazol-1-yl)methyl]benzoate
PubChem CID646984
Molecular FormulaC12H11ClN2O2
Molecular Weight250.69 g/mol
Exact Mass250.05
IUPAC Namemethyl 4-[(4-chloropyrazol-1-yl)methyl]benzoate
SMILESCOC(=O)c1ccc(Cn2cc(Cl)cn2)cc1
InChIInChI=1S/C12H11ClN2O2/c1-17-12(16)10-4-2-9(3-5-10)7-15-8-11(13)6-14-15/h2-6,8H,7H2,1H3
InChIKeyRSGAWEZPVHSTLH-UHFFFAOYSA-N
XLogP2.37
TPSA44.12 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.69
LogP ≤ 52.37
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 4-[(4-chloropyrazol-1-yl)methyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[(4-chloropyrazol-1-yl)methyl]benzoate?
The IUPAC name of methyl 4-[(4-chloropyrazol-1-yl)methyl]benzoate (CID 646984) is methyl 4-[(4-chloropyrazol-1-yl)methyl]benzoate.
What is the SMILES notation for methyl 4-[(4-chloropyrazol-1-yl)methyl]benzoate?
The canonical SMILES for methyl 4-[(4-chloropyrazol-1-yl)methyl]benzoate is COC(=O)c1ccc(Cn2cc(Cl)cn2)cc1.
What is the InChIKey of methyl 4-[(4-chloropyrazol-1-yl)methyl]benzoate?
The InChIKey is RSGAWEZPVHSTLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClN2O2/c1-17-12(16)10-4-2-9(3-5-10)7-15-8-11(13)6-14-15/h2-6,8H,7H2,1H3.
What are the key properties of methyl 4-[(4-chloropyrazol-1-yl)methyl]benzoate?
methyl 4-[(4-chloropyrazol-1-yl)methyl]benzoate has a molecular weight of 250.69 g/mol, XLogP of 2.37, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(4-chloropyrazol-1-yl)methyl]benzoate is sourced from PubChem (CID 646984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).