About 8-ethyl-2,2-dimethyl-3H-chromen-4-one
8-ethyl-2,2-dimethyl-3H-chromen-4-one (PubChem CID 64698496) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is 8-ethyl-2,2-dimethyl-3H-chromen-4-one.
Molecular Properties
| Compound Name | 8-ethyl-2,2-dimethyl-3H-chromen-4-one |
| PubChem CID | 64698496 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 8-ethyl-2,2-dimethyl-3H-chromen-4-one |
| SMILES | CCc1cccc2c1OC(C)(C)CC2=O |
| InChI | InChI=1S/C13H16O2/c1-4-9-6-5-7-10-11(14)8-13(2,3)15-12(9)10/h5-7H,4,8H2,1-3H3 |
| InChIKey | RNHXZSYWHXKQTB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-ethyl-2,2-dimethyl-3H-chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethyl-2,2-dimethyl-3H-chromen-4-one?
The IUPAC name of 8-ethyl-2,2-dimethyl-3H-chromen-4-one (CID 64698496) is 8-ethyl-2,2-dimethyl-3H-chromen-4-one.
What is the SMILES notation for 8-ethyl-2,2-dimethyl-3H-chromen-4-one?
The canonical SMILES for 8-ethyl-2,2-dimethyl-3H-chromen-4-one is CCc1cccc2c1OC(C)(C)CC2=O.
What is the InChIKey of 8-ethyl-2,2-dimethyl-3H-chromen-4-one?
The InChIKey is RNHXZSYWHXKQTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2/c1-4-9-6-5-7-10-11(14)8-13(2,3)15-12(9)10/h5-7H,4,8H2,1-3H3.
What are the key properties of 8-ethyl-2,2-dimethyl-3H-chromen-4-one?
8-ethyl-2,2-dimethyl-3H-chromen-4-one has a molecular weight of 204.27 g/mol, XLogP of 2.99, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethyl-2,2-dimethyl-3H-chromen-4-one is sourced from PubChem (CID 64698496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).