C18H29N3 — CID 64699136
4-(N-ethyl-2-methylanilino)-2-methyl-2-(propylamino)pentanenitrile (PubChem CID 64699136) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is 4-(N-ethyl-2-methylanilino)-2-methyl-2-(propylamino)pentanenitrile.
| Compound Name | 4-(N-ethyl-2-methylanilino)-2-methyl-2-(propylamino)pentanenitrile |
|---|---|
| PubChem CID | 64699136 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | 4-(N-ethyl-2-methylanilino)-2-methyl-2-(propylamino)pentanenitrile |
| SMILES | CCCNC(C)(C#N)CC(C)N(CC)c1ccccc1C |
| InChI | InChI=1S/C18H29N3/c1-6-12-20-18(5,14-19)13-16(4)21(7-2)17-11-9-8-10-15(17)3/h8-11,16,20H,6-7,12-13H2,1-5H3 |
| InChIKey | SVCQOWLMUNESCC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |