About 8-chloro-6-fluoro-2,2-dimethyl-N-propyl-3,4-dihydrochromen-4-amine
8-chloro-6-fluoro-2,2-dimethyl-N-propyl-3,4-dihydrochromen-4-amine (PubChem CID 64699313) has the molecular formula C14H19ClFNO
and a molecular weight of 271.76 g/mol. Its IUPAC name is 8-chloro-6-fluoro-2,2-dimethyl-N-propyl-3,4-dihydrochromen-4-amine.
Molecular Properties
| Compound Name | 8-chloro-6-fluoro-2,2-dimethyl-N-propyl-3,4-dihydrochromen-4-amine |
| PubChem CID | 64699313 |
| Molecular Formula | C14H19ClFNO |
| Molecular Weight | 271.76 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 8-chloro-6-fluoro-2,2-dimethyl-N-propyl-3,4-dihydrochromen-4-amine |
| SMILES | CCCNC1CC(C)(C)Oc2c(Cl)cc(F)cc21 |
| InChI | InChI=1S/C14H19ClFNO/c1-4-5-17-12-8-14(2,3)18-13-10(12)6-9(16)7-11(13)15/h6-7,12,17H,4-5,8H2,1-3H3 |
| InChIKey | RUBRINDAOXOKHM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.76 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-chloro-6-fluoro-2,2-dimethyl-N-propyl-3,4-dihydrochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-6-fluoro-2,2-dimethyl-N-propyl-3,4-dihydrochromen-4-amine?
The IUPAC name of 8-chloro-6-fluoro-2,2-dimethyl-N-propyl-3,4-dihydrochromen-4-amine (CID 64699313) is 8-chloro-6-fluoro-2,2-dimethyl-N-propyl-3,4-dihydrochromen-4-amine.
What is the SMILES notation for 8-chloro-6-fluoro-2,2-dimethyl-N-propyl-3,4-dihydrochromen-4-amine?
The canonical SMILES for 8-chloro-6-fluoro-2,2-dimethyl-N-propyl-3,4-dihydrochromen-4-amine is CCCNC1CC(C)(C)Oc2c(Cl)cc(F)cc21.
What is the InChIKey of 8-chloro-6-fluoro-2,2-dimethyl-N-propyl-3,4-dihydrochromen-4-amine?
The InChIKey is RUBRINDAOXOKHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19ClFNO/c1-4-5-17-12-8-14(2,3)18-13-10(12)6-9(16)7-11(13)15/h6-7,12,17H,4-5,8H2,1-3H3.
What are the key properties of 8-chloro-6-fluoro-2,2-dimethyl-N-propyl-3,4-dihydrochromen-4-amine?
8-chloro-6-fluoro-2,2-dimethyl-N-propyl-3,4-dihydrochromen-4-amine has a molecular weight of 271.76 g/mol, XLogP of 4.08, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-6-fluoro-2,2-dimethyl-N-propyl-3,4-dihydrochromen-4-amine is sourced from PubChem (CID 64699313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).