2-[1-[(4-methyl-1,3-thiazol-2-yl)amino]cyclopentyl]acetic acid

C11H16N2O2S — CID 64699603

IUPAC2-[1-[(4-methyl-1,3-thiazol-2-yl)amino]cyclopentyl]acetic acid
SMILESCc1csc(NC2(CC(=O)O)CCCC2)n1
InChIInChI=1S/C11H16N2O2S/c1-8-7-16-10(12-8)13-11(6-9(14)15)4-2-3-5-11/h7H,2-6H2,1H3,(H,12,13)(H,14,15)
InChIKeyXNQOTXLJLJRMIH-UHFFFAOYSA-N
MW240.33 g/mol
LogP2.65
Rot. Bonds4

About 2-[1-[(4-methyl-1,3-thiazol-2-yl)amino]cyclopentyl]acetic acid

2-[1-[(4-methyl-1,3-thiazol-2-yl)amino]cyclopentyl]acetic acid (PubChem CID 64699603) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is 2-[1-[(4-methyl-1,3-thiazol-2-yl)amino]cyclopentyl]acetic acid.

Molecular Properties

Compound Name2-[1-[(4-methyl-1,3-thiazol-2-yl)amino]cyclopentyl]acetic acid
PubChem CID64699603
Molecular FormulaC11H16N2O2S
Molecular Weight240.33 g/mol
Exact Mass240.09
IUPAC Name2-[1-[(4-methyl-1,3-thiazol-2-yl)amino]cyclopentyl]acetic acid
SMILESCc1csc(NC2(CC(=O)O)CCCC2)n1
InChIInChI=1S/C11H16N2O2S/c1-8-7-16-10(12-8)13-11(6-9(14)15)4-2-3-5-11/h7H,2-6H2,1H3,(H,12,13)(H,14,15)
InChIKeyXNQOTXLJLJRMIH-UHFFFAOYSA-N
XLogP2.65
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.33
LogP ≤ 52.65
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[1-[(4-methyl-1,3-thiazol-2-yl)amino]cyclopentyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-[(4-methyl-1,3-thiazol-2-yl)amino]cyclopentyl]acetic acid?
The IUPAC name of 2-[1-[(4-methyl-1,3-thiazol-2-yl)amino]cyclopentyl]acetic acid (CID 64699603) is 2-[1-[(4-methyl-1,3-thiazol-2-yl)amino]cyclopentyl]acetic acid.
What is the SMILES notation for 2-[1-[(4-methyl-1,3-thiazol-2-yl)amino]cyclopentyl]acetic acid?
The canonical SMILES for 2-[1-[(4-methyl-1,3-thiazol-2-yl)amino]cyclopentyl]acetic acid is Cc1csc(NC2(CC(=O)O)CCCC2)n1.
What is the InChIKey of 2-[1-[(4-methyl-1,3-thiazol-2-yl)amino]cyclopentyl]acetic acid?
The InChIKey is XNQOTXLJLJRMIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2S/c1-8-7-16-10(12-8)13-11(6-9(14)15)4-2-3-5-11/h7H,2-6H2,1H3,(H,12,13)(H,14,15).
What are the key properties of 2-[1-[(4-methyl-1,3-thiazol-2-yl)amino]cyclopentyl]acetic acid?
2-[1-[(4-methyl-1,3-thiazol-2-yl)amino]cyclopentyl]acetic acid has a molecular weight of 240.33 g/mol, XLogP of 2.65, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(4-methyl-1,3-thiazol-2-yl)amino]cyclopentyl]acetic acid is sourced from PubChem (CID 64699603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).