C16H27NO2S — CID 64704189
4-[(3-methylphenyl)methylsulfonyl]-N-propylpentan-2-amine (PubChem CID 64704189) has the molecular formula C16H27NO2S and a molecular weight of 297.46 g/mol. Its IUPAC name is 4-[(3-methylphenyl)methylsulfonyl]-N-propylpentan-2-amine.
| Compound Name | 4-[(3-methylphenyl)methylsulfonyl]-N-propylpentan-2-amine |
|---|---|
| PubChem CID | 64704189 |
| Molecular Formula | C16H27NO2S |
| Molecular Weight | 297.46 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 4-[(3-methylphenyl)methylsulfonyl]-N-propylpentan-2-amine |
| SMILES | CCCNC(C)CC(C)S(=O)(=O)Cc1cccc(C)c1 |
| InChI | InChI=1S/C16H27NO2S/c1-5-9-17-14(3)11-15(4)20(18,19)12-16-8-6-7-13(2)10-16/h6-8,10,14-15,17H,5,9,11-12H2,1-4H3 |
| InChIKey | QQPWTAPANDYAPJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |