C14H30N4O — CID 64704195
4-(4-ethyl-3-methylpiperazin-1-yl)-2-methyl-2-(methylamino)pentanamide (PubChem CID 64704195) has the molecular formula C14H30N4O and a molecular weight of 270.42 g/mol. Its IUPAC name is 4-(4-ethyl-3-methylpiperazin-1-yl)-2-methyl-2-(methylamino)pentanamide.
| Compound Name | 4-(4-ethyl-3-methylpiperazin-1-yl)-2-methyl-2-(methylamino)pentanamide |
|---|---|
| PubChem CID | 64704195 |
| Molecular Formula | C14H30N4O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.24 |
| IUPAC Name | 4-(4-ethyl-3-methylpiperazin-1-yl)-2-methyl-2-(methylamino)pentanamide |
| SMILES | CCN1CCN(C(C)CC(C)(NC)C(N)=O)CC1C |
| InChI | InChI=1S/C14H30N4O/c1-6-17-7-8-18(10-12(17)3)11(2)9-14(4,16-5)13(15)19/h11-12,16H,6-10H2,1-5H3,(H2,15,19) |
| InChIKey | BCIKUKYDBPUOPW-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |