C14H29NO3 — CID 64708806
2-methyl-4-(2-methylbutan-2-yloxy)-2-(propylamino)pentanoic acid (PubChem CID 64708806) has the molecular formula C14H29NO3 and a molecular weight of 259.39 g/mol. Its IUPAC name is 2-methyl-4-(2-methylbutan-2-yloxy)-2-(propylamino)pentanoic acid.
| Compound Name | 2-methyl-4-(2-methylbutan-2-yloxy)-2-(propylamino)pentanoic acid |
|---|---|
| PubChem CID | 64708806 |
| Molecular Formula | C14H29NO3 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | 2-methyl-4-(2-methylbutan-2-yloxy)-2-(propylamino)pentanoic acid |
| SMILES | CCCNC(C)(CC(C)OC(C)(C)CC)C(=O)O |
| InChI | InChI=1S/C14H29NO3/c1-7-9-15-14(6,12(16)17)10-11(3)18-13(4,5)8-2/h11,15H,7-10H2,1-6H3,(H,16,17) |
| InChIKey | HICHMAFHRZKOJE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |