C21H27ClN6O — CID 647089
1-(3-chlorophenyl)-4-[1-[1-(furan-2-ylmethyl)tetrazol-5-yl]-3-methylbutyl]piperazine (PubChem CID 647089) has the molecular formula C21H27ClN6O and a molecular weight of 414.94 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-[1-[1-(furan-2-ylmethyl)tetrazol-5-yl]-3-methylbutyl]piperazine.
| Compound Name | 1-(3-chlorophenyl)-4-[1-[1-(furan-2-ylmethyl)tetrazol-5-yl]-3-methylbutyl]piperazine |
|---|---|
| PubChem CID | 647089 |
| Molecular Formula | C21H27ClN6O |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 1-(3-chlorophenyl)-4-[1-[1-(furan-2-ylmethyl)tetrazol-5-yl]-3-methylbutyl]piperazine |
| SMILES | CC(C)CC(c1nnnn1Cc1ccco1)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C21H27ClN6O/c1-16(2)13-20(21-23-24-25-28(21)15-19-7-4-12-29-19)27-10-8-26(9-11-27)18-6-3-5-17(22)14-18/h3-7,12,14,16,20H,8-11,13,15H2,1-2H3 |
| InChIKey | DHBLPTGCNONYOA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |