C15H30N2O3 — CID 64709693
4-[cyclopropyl(2-methoxyethyl)amino]-2-methyl-2-(propan-2-ylamino)pentanoic acid (PubChem CID 64709693) has the molecular formula C15H30N2O3 and a molecular weight of 286.42 g/mol. Its IUPAC name is 4-[cyclopropyl(2-methoxyethyl)amino]-2-methyl-2-(propan-2-ylamino)pentanoic acid.
| Compound Name | 4-[cyclopropyl(2-methoxyethyl)amino]-2-methyl-2-(propan-2-ylamino)pentanoic acid |
|---|---|
| PubChem CID | 64709693 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 4-[cyclopropyl(2-methoxyethyl)amino]-2-methyl-2-(propan-2-ylamino)pentanoic acid |
| SMILES | COCCN(C(C)CC(C)(NC(C)C)C(=O)O)C1CC1 |
| InChI | InChI=1S/C15H30N2O3/c1-11(2)16-15(4,14(18)19)10-12(3)17(8-9-20-5)13-6-7-13/h11-13,16H,6-10H2,1-5H3,(H,18,19) |
| InChIKey | IFYGEHPILIHGMV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |