C15H29N3O2 — CID 64709929
4-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-methyl-2-(methylamino)pentanamide (PubChem CID 64709929) has the molecular formula C15H29N3O2 and a molecular weight of 283.42 g/mol. Its IUPAC name is 4-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-methyl-2-(methylamino)pentanamide.
| Compound Name | 4-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-methyl-2-(methylamino)pentanamide |
|---|---|
| PubChem CID | 64709929 |
| Molecular Formula | C15H29N3O2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | 4-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-methyl-2-(methylamino)pentanamide |
| SMILES | CNC(C)(CC(C)N1CCOC2CCCCC21)C(N)=O |
| InChI | InChI=1S/C15H29N3O2/c1-11(10-15(2,17-3)14(16)19)18-8-9-20-13-7-5-4-6-12(13)18/h11-13,17H,4-10H2,1-3H3,(H2,16,19) |
| InChIKey | AASDRIMPWQOSMN-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |