C16H32N2O3 — CID 64710194
ethyl 2-(ethylamino)-2-methyl-4-[methyl(oxan-4-yl)amino]pentanoate (PubChem CID 64710194) has the molecular formula C16H32N2O3 and a molecular weight of 300.44 g/mol. Its IUPAC name is ethyl 2-(ethylamino)-2-methyl-4-[methyl(oxan-4-yl)amino]pentanoate.
| Compound Name | ethyl 2-(ethylamino)-2-methyl-4-[methyl(oxan-4-yl)amino]pentanoate |
|---|---|
| PubChem CID | 64710194 |
| Molecular Formula | C16H32N2O3 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.24 |
| IUPAC Name | ethyl 2-(ethylamino)-2-methyl-4-[methyl(oxan-4-yl)amino]pentanoate |
| SMILES | CCNC(C)(CC(C)N(C)C1CCOCC1)C(=O)OCC |
| InChI | InChI=1S/C16H32N2O3/c1-6-17-16(4,15(19)21-7-2)12-13(3)18(5)14-8-10-20-11-9-14/h13-14,17H,6-12H2,1-5H3 |
| InChIKey | XZWLVXPAPBFZKS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |