C24H26N4O5 — CID 647126
N-[3-[(3-cyano-6-methoxyquinolin-2-yl)amino]propyl]-3,4,5-trimethoxybenzamide (PubChem CID 647126) has the molecular formula C24H26N4O5 and a molecular weight of 450.50 g/mol. Its IUPAC name is N-[3-[(3-cyano-6-methoxyquinolin-2-yl)amino]propyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[3-[(3-cyano-6-methoxyquinolin-2-yl)amino]propyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 647126 |
| Molecular Formula | C24H26N4O5 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | N-[3-[(3-cyano-6-methoxyquinolin-2-yl)amino]propyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1ccc2nc(NCCCNC(=O)c3cc(OC)c(OC)c(OC)c3)c(C#N)cc2c1 |
| InChI | InChI=1S/C24H26N4O5/c1-30-18-6-7-19-15(11-18)10-17(14-25)23(28-19)26-8-5-9-27-24(29)16-12-20(31-2)22(33-4)21(13-16)32-3/h6-7,10-13H,5,8-9H2,1-4H3,(H,26,28)(H,27,29) |
| InChIKey | MOGWDYXRKFQPLL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|