C15H24N4O3S2 — CID 6471374
N-(5-butan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)-1-(1-methoxypropan-2-yl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 6471374) has the molecular formula C15H24N4O3S2 and a molecular weight of 372.52 g/mol. Its IUPAC name is N-(5-butan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)-1-(1-methoxypropan-2-yl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(5-butan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)-1-(1-methoxypropan-2-yl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 6471374 |
| Molecular Formula | C15H24N4O3S2 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | N-(5-butan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)-1-(1-methoxypropan-2-yl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCC(C)Sc1nnc(NC(=O)C2CC(=O)N(C(C)COC)C2)s1 |
| InChI | InChI=1S/C15H24N4O3S2/c1-5-10(3)23-15-18-17-14(24-15)16-13(21)11-6-12(20)19(7-11)9(2)8-22-4/h9-11H,5-8H2,1-4H3,(H,16,17,21) |
| InChIKey | JOQNWGLCEGIOKR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|