C12H11F3N2O4 — CID 64714832
(2S,4S)-4-hydroxy-1-[(3,4,5-trifluorophenyl)carbamoyl]pyrrolidine-2-carboxylic acid (PubChem CID 64714832) has the molecular formula C12H11F3N2O4 and a molecular weight of 304.22 g/mol. Its IUPAC name is (2S,4S)-4-hydroxy-1-[(3,4,5-trifluorophenyl)carbamoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-4-hydroxy-1-[(3,4,5-trifluorophenyl)carbamoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 64714832 |
| Molecular Formula | C12H11F3N2O4 |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | (2S,4S)-4-hydroxy-1-[(3,4,5-trifluorophenyl)carbamoyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@H](O)CN1C(=O)Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H11F3N2O4/c13-7-1-5(2-8(14)10(7)15)16-12(21)17-4-6(18)3-9(17)11(19)20/h1-2,6,9,18H,3-4H2,(H,16,21)(H,19,20)/t6-,9-/m0/s1 |
| InChIKey | TXHBTZAVLHDNCB-RCOVLWMOSA-N |
| XLogP | 1.16 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|