C18H18N4O — CID 6471517
2,8,8-trimethyl-3-phenyl-7,9-dihydropyrazolo[5,1-c][1,2,4]benzotriazin-6-one (PubChem CID 6471517) has the molecular formula C18H18N4O and a molecular weight of 306.37 g/mol. Its IUPAC name is 2,8,8-trimethyl-3-phenyl-7,9-dihydropyrazolo[5,1-c][1,2,4]benzotriazin-6-one.
| Compound Name | 2,8,8-trimethyl-3-phenyl-7,9-dihydropyrazolo[5,1-c][1,2,4]benzotriazin-6-one |
|---|---|
| PubChem CID | 6471517 |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 2,8,8-trimethyl-3-phenyl-7,9-dihydropyrazolo[5,1-c][1,2,4]benzotriazin-6-one |
| SMILES | Cc1nn2c3c(nnc2c1-c1ccccc1)C(=O)CC(C)(C)C3 |
| InChI | InChI=1S/C18H18N4O/c1-11-15(12-7-5-4-6-8-12)17-20-19-16-13(22(17)21-11)9-18(2,3)10-14(16)23/h4-8H,9-10H2,1-3H3 |
| InChIKey | PRZOEDQNYJYZAD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 60.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |