C11H20ClF3O — CID 64716847
6-chloro-4,4-dimethyl-1-(2,2,2-trifluoroethoxy)heptane (PubChem CID 64716847) has the molecular formula C11H20ClF3O and a molecular weight of 260.73 g/mol. Its IUPAC name is 6-chloro-4,4-dimethyl-1-(2,2,2-trifluoroethoxy)heptane.
| Compound Name | 6-chloro-4,4-dimethyl-1-(2,2,2-trifluoroethoxy)heptane |
|---|---|
| PubChem CID | 64716847 |
| Molecular Formula | C11H20ClF3O |
| Molecular Weight | 260.73 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 6-chloro-4,4-dimethyl-1-(2,2,2-trifluoroethoxy)heptane |
| SMILES | CC(Cl)CC(C)(C)CCCOCC(F)(F)F |
| InChI | InChI=1S/C11H20ClF3O/c1-9(12)7-10(2,3)5-4-6-16-8-11(13,14)15/h9H,4-8H2,1-3H3 |
| InChIKey | XIKDHSYHFLBWKI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.73 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|