C11H11FN2O2S — CID 64716914
2-ethyl-5-[(4-fluorophenyl)sulfinylmethyl]-1,3,4-oxadiazole (PubChem CID 64716914) has the molecular formula C11H11FN2O2S and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-ethyl-5-[(4-fluorophenyl)sulfinylmethyl]-1,3,4-oxadiazole.
| Compound Name | 2-ethyl-5-[(4-fluorophenyl)sulfinylmethyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 64716914 |
| Molecular Formula | C11H11FN2O2S |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 2-ethyl-5-[(4-fluorophenyl)sulfinylmethyl]-1,3,4-oxadiazole |
| SMILES | CCc1nnc(CS(=O)c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C11H11FN2O2S/c1-2-10-13-14-11(16-10)7-17(15)9-5-3-8(12)4-6-9/h3-6H,2,7H2,1H3 |
| InChIKey | YNCRTZIKQSGCNI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |