C14H19Cl2NOS — CID 64716958
3-(2,5-dichlorophenyl)sulfinyl-N-ethylcyclohexan-1-amine (PubChem CID 64716958) has the molecular formula C14H19Cl2NOS and a molecular weight of 320.29 g/mol. Its IUPAC name is 3-(2,5-dichlorophenyl)sulfinyl-N-ethylcyclohexan-1-amine.
| Compound Name | 3-(2,5-dichlorophenyl)sulfinyl-N-ethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64716958 |
| Molecular Formula | C14H19Cl2NOS |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 3-(2,5-dichlorophenyl)sulfinyl-N-ethylcyclohexan-1-amine |
| SMILES | CCNC1CCCC(S(=O)c2cc(Cl)ccc2Cl)C1 |
| InChI | InChI=1S/C14H19Cl2NOS/c1-2-17-11-4-3-5-12(9-11)19(18)14-8-10(15)6-7-13(14)16/h6-8,11-12,17H,2-5,9H2,1H3 |
| InChIKey | JMGFLIOZEUEXQJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |