C13H17BrClF — CID 64717266
1-(4-bromo-2,2-dimethylpentyl)-2-chloro-4-fluorobenzene (PubChem CID 64717266) has the molecular formula C13H17BrClF and a molecular weight of 307.63 g/mol. Its IUPAC name is 1-(4-bromo-2,2-dimethylpentyl)-2-chloro-4-fluorobenzene.
| Compound Name | 1-(4-bromo-2,2-dimethylpentyl)-2-chloro-4-fluorobenzene |
|---|---|
| PubChem CID | 64717266 |
| Molecular Formula | C13H17BrClF |
| Molecular Weight | 307.63 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 1-(4-bromo-2,2-dimethylpentyl)-2-chloro-4-fluorobenzene |
| SMILES | CC(Br)CC(C)(C)Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C13H17BrClF/c1-9(14)7-13(2,3)8-10-4-5-11(16)6-12(10)15/h4-6,9H,7-8H2,1-3H3 |
| InChIKey | QCVNUEWPMCNXIV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.63 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|