C16H12F2N2S — CID 64717494
[2-(2,5-difluorophenyl)-5-phenyl-1,3-thiazol-4-yl]methanamine (PubChem CID 64717494) has the molecular formula C16H12F2N2S and a molecular weight of 302.35 g/mol. Its IUPAC name is [2-(2,5-difluorophenyl)-5-phenyl-1,3-thiazol-4-yl]methanamine.
| Compound Name | [2-(2,5-difluorophenyl)-5-phenyl-1,3-thiazol-4-yl]methanamine |
|---|---|
| PubChem CID | 64717494 |
| Molecular Formula | C16H12F2N2S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | [2-(2,5-difluorophenyl)-5-phenyl-1,3-thiazol-4-yl]methanamine |
| SMILES | NCc1nc(-c2cc(F)ccc2F)sc1-c1ccccc1 |
| InChI | InChI=1S/C16H12F2N2S/c17-11-6-7-13(18)12(8-11)16-20-14(9-19)15(21-16)10-4-2-1-3-5-10/h1-8H,9,19H2 |
| InChIKey | WZCUZTZLKDXTFG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |