C15H25NO — CID 64718083
N-ethyl-4-(2-methoxyphenyl)-4-methylpentan-2-amine (PubChem CID 64718083) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is N-ethyl-4-(2-methoxyphenyl)-4-methylpentan-2-amine.
| Compound Name | N-ethyl-4-(2-methoxyphenyl)-4-methylpentan-2-amine |
|---|---|
| PubChem CID | 64718083 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | N-ethyl-4-(2-methoxyphenyl)-4-methylpentan-2-amine |
| SMILES | CCNC(C)CC(C)(C)c1ccccc1OC |
| InChI | InChI=1S/C15H25NO/c1-6-16-12(2)11-15(3,4)13-9-7-8-10-14(13)17-5/h7-10,12,16H,6,11H2,1-5H3 |
| InChIKey | CJHHEBKYVFUXCQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |