About 5,7-dibromo-N-ethyl-2,3-dihydro-1-benzofuran-3-amine
5,7-dibromo-N-ethyl-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 64719518) has the molecular formula C10H11Br2NO
and a molecular weight of 321.01 g/mol. Its IUPAC name is 5,7-dibromo-N-ethyl-2,3-dihydro-1-benzofuran-3-amine.
Molecular Properties
| Compound Name | 5,7-dibromo-N-ethyl-2,3-dihydro-1-benzofuran-3-amine |
| PubChem CID | 64719518 |
| Molecular Formula | C10H11Br2NO |
| Molecular Weight | 321.01 g/mol |
| Exact Mass | 318.92 |
| IUPAC Name | 5,7-dibromo-N-ethyl-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | CCNC1COc2c(Br)cc(Br)cc21 |
| InChI | InChI=1S/C10H11Br2NO/c1-2-13-9-5-14-10-7(9)3-6(11)4-8(10)12/h3-4,9,13H,2,5H2,1H3 |
| InChIKey | MLIFUPNODPUYHX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.01 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,7-dibromo-N-ethyl-2,3-dihydro-1-benzofuran-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dibromo-N-ethyl-2,3-dihydro-1-benzofuran-3-amine?
The IUPAC name of 5,7-dibromo-N-ethyl-2,3-dihydro-1-benzofuran-3-amine (CID 64719518) is 5,7-dibromo-N-ethyl-2,3-dihydro-1-benzofuran-3-amine.
What is the SMILES notation for 5,7-dibromo-N-ethyl-2,3-dihydro-1-benzofuran-3-amine?
The canonical SMILES for 5,7-dibromo-N-ethyl-2,3-dihydro-1-benzofuran-3-amine is CCNC1COc2c(Br)cc(Br)cc21.
What is the InChIKey of 5,7-dibromo-N-ethyl-2,3-dihydro-1-benzofuran-3-amine?
The InChIKey is MLIFUPNODPUYHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Br2NO/c1-2-13-9-5-14-10-7(9)3-6(11)4-8(10)12/h3-4,9,13H,2,5H2,1H3.
What are the key properties of 5,7-dibromo-N-ethyl-2,3-dihydro-1-benzofuran-3-amine?
5,7-dibromo-N-ethyl-2,3-dihydro-1-benzofuran-3-amine has a molecular weight of 321.01 g/mol, XLogP of 3.25, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dibromo-N-ethyl-2,3-dihydro-1-benzofuran-3-amine is sourced from PubChem (CID 64719518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).