C13H11Br2N3O3 — CID 64719785
[2-[(2,4-dibromophenoxy)methyl]-4-nitrophenyl]hydrazine (PubChem CID 64719785) has the molecular formula C13H11Br2N3O3 and a molecular weight of 417.06 g/mol. Its IUPAC name is [2-[(2,4-dibromophenoxy)methyl]-4-nitrophenyl]hydrazine.
| Compound Name | [2-[(2,4-dibromophenoxy)methyl]-4-nitrophenyl]hydrazine |
|---|---|
| PubChem CID | 64719785 |
| Molecular Formula | C13H11Br2N3O3 |
| Molecular Weight | 417.06 g/mol |
| Exact Mass | 414.92 |
| IUPAC Name | [2-[(2,4-dibromophenoxy)methyl]-4-nitrophenyl]hydrazine |
| SMILES | NNc1ccc([N+](=O)[O-])cc1COc1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H11Br2N3O3/c14-9-1-4-13(11(15)6-9)21-7-8-5-10(18(19)20)2-3-12(8)17-16/h1-6,17H,7,16H2 |
| InChIKey | YPQAHIMIEHILNV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.06 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|