C14H12Br2FNO — CID 64719989
1-[4-(2,4-dibromophenoxy)-3-fluorophenyl]ethanamine (PubChem CID 64719989) has the molecular formula C14H12Br2FNO and a molecular weight of 389.06 g/mol. Its IUPAC name is 1-[4-(2,4-dibromophenoxy)-3-fluorophenyl]ethanamine.
| Compound Name | 1-[4-(2,4-dibromophenoxy)-3-fluorophenyl]ethanamine |
|---|---|
| PubChem CID | 64719989 |
| Molecular Formula | C14H12Br2FNO |
| Molecular Weight | 389.06 g/mol |
| Exact Mass | 386.93 |
| IUPAC Name | 1-[4-(2,4-dibromophenoxy)-3-fluorophenyl]ethanamine |
| SMILES | CC(N)c1ccc(Oc2ccc(Br)cc2Br)c(F)c1 |
| InChI | InChI=1S/C14H12Br2FNO/c1-8(18)9-2-4-14(12(17)6-9)19-13-5-3-10(15)7-11(13)16/h2-8H,18H2,1H3 |
| InChIKey | IBFRWYOJDWKWFG-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.06 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |