About methyl 4-(1-methylpyrrol-2-yl)-2,4-dioxobutanoate
methyl 4-(1-methylpyrrol-2-yl)-2,4-dioxobutanoate (PubChem CID 6472067) has the molecular formula C10H11NO4
and a molecular weight of 209.20 g/mol. Its IUPAC name is methyl 4-(1-methylpyrrol-2-yl)-2,4-dioxobutanoate.
Molecular Properties
| Compound Name | methyl 4-(1-methylpyrrol-2-yl)-2,4-dioxobutanoate |
| PubChem CID | 6472067 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | methyl 4-(1-methylpyrrol-2-yl)-2,4-dioxobutanoate |
| SMILES | COC(=O)C(=O)CC(=O)c1cccn1C |
| InChI | InChI=1S/C10H11NO4/c1-11-5-3-4-7(11)8(12)6-9(13)10(14)15-2/h3-5H,6H2,1-2H3 |
| InChIKey | VUQQWMLOBDJKKW-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(1-methylpyrrol-2-yl)-2,4-dioxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(1-methylpyrrol-2-yl)-2,4-dioxobutanoate?
The IUPAC name of methyl 4-(1-methylpyrrol-2-yl)-2,4-dioxobutanoate (CID 6472067) is methyl 4-(1-methylpyrrol-2-yl)-2,4-dioxobutanoate.
What is the SMILES notation for methyl 4-(1-methylpyrrol-2-yl)-2,4-dioxobutanoate?
The canonical SMILES for methyl 4-(1-methylpyrrol-2-yl)-2,4-dioxobutanoate is COC(=O)C(=O)CC(=O)c1cccn1C.
What is the InChIKey of methyl 4-(1-methylpyrrol-2-yl)-2,4-dioxobutanoate?
The InChIKey is VUQQWMLOBDJKKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO4/c1-11-5-3-4-7(11)8(12)6-9(13)10(14)15-2/h3-5H,6H2,1-2H3.
What are the key properties of methyl 4-(1-methylpyrrol-2-yl)-2,4-dioxobutanoate?
methyl 4-(1-methylpyrrol-2-yl)-2,4-dioxobutanoate has a molecular weight of 209.20 g/mol, XLogP of 0.34, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(1-methylpyrrol-2-yl)-2,4-dioxobutanoate is sourced from PubChem (CID 6472067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).