C16H16Br2ClNO — CID 64721082
1-[2-chloro-4-(2,4-dibromophenoxy)phenyl]-N-ethylethanamine (PubChem CID 64721082) has the molecular formula C16H16Br2ClNO and a molecular weight of 433.57 g/mol. Its IUPAC name is 1-[2-chloro-4-(2,4-dibromophenoxy)phenyl]-N-ethylethanamine.
| Compound Name | 1-[2-chloro-4-(2,4-dibromophenoxy)phenyl]-N-ethylethanamine |
|---|---|
| PubChem CID | 64721082 |
| Molecular Formula | C16H16Br2ClNO |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 430.93 |
| IUPAC Name | 1-[2-chloro-4-(2,4-dibromophenoxy)phenyl]-N-ethylethanamine |
| SMILES | CCNC(C)c1ccc(Oc2ccc(Br)cc2Br)cc1Cl |
| InChI | InChI=1S/C16H16Br2ClNO/c1-3-20-10(2)13-6-5-12(9-15(13)19)21-16-7-4-11(17)8-14(16)18/h4-10,20H,3H2,1-2H3 |
| InChIKey | NVLWVJKHKSVATL-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |