C14H19F2NO3 — CID 64721123
ethyl 2-amino-4-(3,4-difluorophenoxy)-2-methylpentanoate (PubChem CID 64721123) has the molecular formula C14H19F2NO3 and a molecular weight of 287.31 g/mol. Its IUPAC name is ethyl 2-amino-4-(3,4-difluorophenoxy)-2-methylpentanoate.
| Compound Name | ethyl 2-amino-4-(3,4-difluorophenoxy)-2-methylpentanoate |
|---|---|
| PubChem CID | 64721123 |
| Molecular Formula | C14H19F2NO3 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | ethyl 2-amino-4-(3,4-difluorophenoxy)-2-methylpentanoate |
| SMILES | CCOC(=O)C(C)(N)CC(C)Oc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H19F2NO3/c1-4-19-13(18)14(3,17)8-9(2)20-10-5-6-11(15)12(16)7-10/h5-7,9H,4,8,17H2,1-3H3 |
| InChIKey | ZUXVVCLGWOOTJQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |