C15H10F4N2 — CID 64722297
2-[4-fluoro-3-(trifluoromethyl)phenyl]-4-methyl-1H-benzimidazole (PubChem CID 64722297) has the molecular formula C15H10F4N2 and a molecular weight of 294.25 g/mol. Its IUPAC name is 2-[4-fluoro-3-(trifluoromethyl)phenyl]-4-methyl-1H-benzimidazole.
| Compound Name | 2-[4-fluoro-3-(trifluoromethyl)phenyl]-4-methyl-1H-benzimidazole |
|---|---|
| PubChem CID | 64722297 |
| Molecular Formula | C15H10F4N2 |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 2-[4-fluoro-3-(trifluoromethyl)phenyl]-4-methyl-1H-benzimidazole |
| SMILES | Cc1cccc2[nH]c(-c3ccc(F)c(C(F)(F)F)c3)nc12 |
| InChI | InChI=1S/C15H10F4N2/c1-8-3-2-4-12-13(8)21-14(20-12)9-5-6-11(16)10(7-9)15(17,18)19/h2-7H,1H3,(H,20,21) |
| InChIKey | BVWJRKRMWIXINO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |