About 3-[(3,5-dimethylcyclohexyl)amino]butanenitrile
3-[(3,5-dimethylcyclohexyl)amino]butanenitrile (PubChem CID 64722971) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is 3-[(3,5-dimethylcyclohexyl)amino]butanenitrile.
Molecular Properties
| Compound Name | 3-[(3,5-dimethylcyclohexyl)amino]butanenitrile |
| PubChem CID | 64722971 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 3-[(3,5-dimethylcyclohexyl)amino]butanenitrile |
| SMILES | CC1CC(C)CC(NC(C)CC#N)C1 |
| InChI | InChI=1S/C12H22N2/c1-9-6-10(2)8-12(7-9)14-11(3)4-5-13/h9-12,14H,4,6-8H2,1-3H3 |
| InChIKey | XDKIGAAPRLBGMI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(3,5-dimethylcyclohexyl)amino]butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,5-dimethylcyclohexyl)amino]butanenitrile?
The IUPAC name of 3-[(3,5-dimethylcyclohexyl)amino]butanenitrile (CID 64722971) is 3-[(3,5-dimethylcyclohexyl)amino]butanenitrile.
What is the SMILES notation for 3-[(3,5-dimethylcyclohexyl)amino]butanenitrile?
The canonical SMILES for 3-[(3,5-dimethylcyclohexyl)amino]butanenitrile is CC1CC(C)CC(NC(C)CC#N)C1.
What is the InChIKey of 3-[(3,5-dimethylcyclohexyl)amino]butanenitrile?
The InChIKey is XDKIGAAPRLBGMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2/c1-9-6-10(2)8-12(7-9)14-11(3)4-5-13/h9-12,14H,4,6-8H2,1-3H3.
What are the key properties of 3-[(3,5-dimethylcyclohexyl)amino]butanenitrile?
3-[(3,5-dimethylcyclohexyl)amino]butanenitrile has a molecular weight of 194.32 g/mol, XLogP of 2.70, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,5-dimethylcyclohexyl)amino]butanenitrile is sourced from PubChem (CID 64722971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).