About 3-(2,5-dimethylphenyl)sulfonyl-N-ethylcyclopentan-1-amine
3-(2,5-dimethylphenyl)sulfonyl-N-ethylcyclopentan-1-amine (PubChem CID 64724868) has the molecular formula C15H23NO2S
and a molecular weight of 281.42 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)sulfonyl-N-ethylcyclopentan-1-amine.
Molecular Properties
| Compound Name | 3-(2,5-dimethylphenyl)sulfonyl-N-ethylcyclopentan-1-amine |
| PubChem CID | 64724868 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 3-(2,5-dimethylphenyl)sulfonyl-N-ethylcyclopentan-1-amine |
| SMILES | CCNC1CCC(S(=O)(=O)c2cc(C)ccc2C)C1 |
| InChI | InChI=1S/C15H23NO2S/c1-4-16-13-7-8-14(10-13)19(17,18)15-9-11(2)5-6-12(15)3/h5-6,9,13-14,16H,4,7-8,10H2,1-3H3 |
| InChIKey | MHUGBJWPSFTWOH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2,5-dimethylphenyl)sulfonyl-N-ethylcyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dimethylphenyl)sulfonyl-N-ethylcyclopentan-1-amine?
The IUPAC name of 3-(2,5-dimethylphenyl)sulfonyl-N-ethylcyclopentan-1-amine (CID 64724868) is 3-(2,5-dimethylphenyl)sulfonyl-N-ethylcyclopentan-1-amine.
What is the SMILES notation for 3-(2,5-dimethylphenyl)sulfonyl-N-ethylcyclopentan-1-amine?
The canonical SMILES for 3-(2,5-dimethylphenyl)sulfonyl-N-ethylcyclopentan-1-amine is CCNC1CCC(S(=O)(=O)c2cc(C)ccc2C)C1.
What is the InChIKey of 3-(2,5-dimethylphenyl)sulfonyl-N-ethylcyclopentan-1-amine?
The InChIKey is MHUGBJWPSFTWOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO2S/c1-4-16-13-7-8-14(10-13)19(17,18)15-9-11(2)5-6-12(15)3/h5-6,9,13-14,16H,4,7-8,10H2,1-3H3.
What are the key properties of 3-(2,5-dimethylphenyl)sulfonyl-N-ethylcyclopentan-1-amine?
3-(2,5-dimethylphenyl)sulfonyl-N-ethylcyclopentan-1-amine has a molecular weight of 281.42 g/mol, XLogP of 2.61, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dimethylphenyl)sulfonyl-N-ethylcyclopentan-1-amine is sourced from PubChem (CID 64724868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).