About 2-methyl-2,3-dihydro-1-benzofuran-5-carboxylic acid
2-methyl-2,3-dihydro-1-benzofuran-5-carboxylic acid (PubChem CID 647255) has the molecular formula C10H10O3
and a molecular weight of 178.19 g/mol. Its IUPAC name is 2-methyl-2,3-dihydro-1-benzofuran-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-methyl-2,3-dihydro-1-benzofuran-5-carboxylic acid |
| PubChem CID | 647255 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 2-methyl-2,3-dihydro-1-benzofuran-5-carboxylic acid |
| SMILES | CC1Cc2cc(C(=O)O)ccc2O1 |
| InChI | InChI=1S/C10H10O3/c1-6-4-8-5-7(10(11)12)2-3-9(8)13-6/h2-3,5-6H,4H2,1H3,(H,11,12) |
| InChIKey | NXNQXQFRCVUXIN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-2,3-dihydro-1-benzofuran-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2,3-dihydro-1-benzofuran-5-carboxylic acid?
The IUPAC name of 2-methyl-2,3-dihydro-1-benzofuran-5-carboxylic acid (CID 647255) is 2-methyl-2,3-dihydro-1-benzofuran-5-carboxylic acid.
What is the SMILES notation for 2-methyl-2,3-dihydro-1-benzofuran-5-carboxylic acid?
The canonical SMILES for 2-methyl-2,3-dihydro-1-benzofuran-5-carboxylic acid is CC1Cc2cc(C(=O)O)ccc2O1.
What is the InChIKey of 2-methyl-2,3-dihydro-1-benzofuran-5-carboxylic acid?
The InChIKey is NXNQXQFRCVUXIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3/c1-6-4-8-5-7(10(11)12)2-3-9(8)13-6/h2-3,5-6H,4H2,1H3,(H,11,12).
What are the key properties of 2-methyl-2,3-dihydro-1-benzofuran-5-carboxylic acid?
2-methyl-2,3-dihydro-1-benzofuran-5-carboxylic acid has a molecular weight of 178.19 g/mol, XLogP of 1.71, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2,3-dihydro-1-benzofuran-5-carboxylic acid is sourced from PubChem (CID 647255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).