C14H25N3O — CID 64725504
4-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-amino-2-methylpentanenitrile (PubChem CID 64725504) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is 4-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-amino-2-methylpentanenitrile.
| Compound Name | 4-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-amino-2-methylpentanenitrile |
|---|---|
| PubChem CID | 64725504 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 4-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-amino-2-methylpentanenitrile |
| SMILES | CC(CC(C)(N)C#N)N1CCOC2CCCCC21 |
| InChI | InChI=1S/C14H25N3O/c1-11(9-14(2,16)10-15)17-7-8-18-13-6-4-3-5-12(13)17/h11-13H,3-9,16H2,1-2H3 |
| InChIKey | SEIZBUSXASSMGG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 62.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |