C15H31N3 — CID 64726084
2-methyl-4-[methyl(pentan-2-yl)amino]-2-(propan-2-ylamino)pentanenitrile (PubChem CID 64726084) has the molecular formula C15H31N3 and a molecular weight of 253.43 g/mol. Its IUPAC name is 2-methyl-4-[methyl(pentan-2-yl)amino]-2-(propan-2-ylamino)pentanenitrile.
| Compound Name | 2-methyl-4-[methyl(pentan-2-yl)amino]-2-(propan-2-ylamino)pentanenitrile |
|---|---|
| PubChem CID | 64726084 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | 2-methyl-4-[methyl(pentan-2-yl)amino]-2-(propan-2-ylamino)pentanenitrile |
| SMILES | CCCC(C)N(C)C(C)CC(C)(C#N)NC(C)C |
| InChI | InChI=1S/C15H31N3/c1-8-9-13(4)18(7)14(5)10-15(6,11-16)17-12(2)3/h12-14,17H,8-10H2,1-7H3 |
| InChIKey | WJLFDOAADVREDN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |