C14H22N4 — CID 64726284
2-amino-2-methyl-4-[methyl(2-pyridin-4-ylethyl)amino]pentanenitrile (PubChem CID 64726284) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is 2-amino-2-methyl-4-[methyl(2-pyridin-4-ylethyl)amino]pentanenitrile.
| Compound Name | 2-amino-2-methyl-4-[methyl(2-pyridin-4-ylethyl)amino]pentanenitrile |
|---|---|
| PubChem CID | 64726284 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 2-amino-2-methyl-4-[methyl(2-pyridin-4-ylethyl)amino]pentanenitrile |
| SMILES | CC(CC(C)(N)C#N)N(C)CCc1ccncc1 |
| InChI | InChI=1S/C14H22N4/c1-12(10-14(2,16)11-15)18(3)9-6-13-4-7-17-8-5-13/h4-5,7-8,12H,6,9-10,16H2,1-3H3 |
| InChIKey | IQMHFVVSHNGOMU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 65.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |