C13H19N3O3 — CID 647264
3-cyclohexyl-N-(2,4-dioxo-1H-pyrimidin-5-yl)propanamide (PubChem CID 647264) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is 3-cyclohexyl-N-(2,4-dioxo-1H-pyrimidin-5-yl)propanamide.
| Compound Name | 3-cyclohexyl-N-(2,4-dioxo-1H-pyrimidin-5-yl)propanamide |
|---|---|
| PubChem CID | 647264 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 3-cyclohexyl-N-(2,4-dioxo-1H-pyrimidin-5-yl)propanamide |
| SMILES | O=C(CCC1CCCCC1)Nc1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H19N3O3/c17-11(7-6-9-4-2-1-3-5-9)15-10-8-14-13(19)16-12(10)18/h8-9H,1-7H2,(H,15,17)(H2,14,16,18,19) |
| InChIKey | LZGPPPRUCWLEJQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |