C17H34N4 — CID 64727327
2-methyl-4-[methyl-[(1-methylpiperidin-4-yl)methyl]amino]-2-(propylamino)pentanenitrile (PubChem CID 64727327) has the molecular formula C17H34N4 and a molecular weight of 294.49 g/mol. Its IUPAC name is 2-methyl-4-[methyl-[(1-methylpiperidin-4-yl)methyl]amino]-2-(propylamino)pentanenitrile.
| Compound Name | 2-methyl-4-[methyl-[(1-methylpiperidin-4-yl)methyl]amino]-2-(propylamino)pentanenitrile |
|---|---|
| PubChem CID | 64727327 |
| Molecular Formula | C17H34N4 |
| Molecular Weight | 294.49 g/mol |
| Exact Mass | 294.28 |
| IUPAC Name | 2-methyl-4-[methyl-[(1-methylpiperidin-4-yl)methyl]amino]-2-(propylamino)pentanenitrile |
| SMILES | CCCNC(C)(C#N)CC(C)N(C)CC1CCN(C)CC1 |
| InChI | InChI=1S/C17H34N4/c1-6-9-19-17(3,14-18)12-15(2)21(5)13-16-7-10-20(4)11-8-16/h15-16,19H,6-13H2,1-5H3 |
| InChIKey | YMQWVYMACXKFPB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 42.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.49 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |