About 2-amino-2-methyl-4-(2,2,2-trifluoroethoxy)pentanenitrile
2-amino-2-methyl-4-(2,2,2-trifluoroethoxy)pentanenitrile (PubChem CID 64728179) has the molecular formula C8H13F3N2O
and a molecular weight of 210.20 g/mol. Its IUPAC name is 2-amino-2-methyl-4-(2,2,2-trifluoroethoxy)pentanenitrile.
Molecular Properties
| Compound Name | 2-amino-2-methyl-4-(2,2,2-trifluoroethoxy)pentanenitrile |
| PubChem CID | 64728179 |
| Molecular Formula | C8H13F3N2O |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 2-amino-2-methyl-4-(2,2,2-trifluoroethoxy)pentanenitrile |
| SMILES | CC(CC(C)(N)C#N)OCC(F)(F)F |
| InChI | InChI=1S/C8H13F3N2O/c1-6(3-7(2,13)4-12)14-5-8(9,10)11/h6H,3,5,13H2,1-2H3 |
| InChIKey | GMFIZUKQYXNZKD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-2-methyl-4-(2,2,2-trifluoroethoxy)pentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-methyl-4-(2,2,2-trifluoroethoxy)pentanenitrile?
The IUPAC name of 2-amino-2-methyl-4-(2,2,2-trifluoroethoxy)pentanenitrile (CID 64728179) is 2-amino-2-methyl-4-(2,2,2-trifluoroethoxy)pentanenitrile.
What is the SMILES notation for 2-amino-2-methyl-4-(2,2,2-trifluoroethoxy)pentanenitrile?
The canonical SMILES for 2-amino-2-methyl-4-(2,2,2-trifluoroethoxy)pentanenitrile is CC(CC(C)(N)C#N)OCC(F)(F)F.
What is the InChIKey of 2-amino-2-methyl-4-(2,2,2-trifluoroethoxy)pentanenitrile?
The InChIKey is GMFIZUKQYXNZKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F3N2O/c1-6(3-7(2,13)4-12)14-5-8(9,10)11/h6H,3,5,13H2,1-2H3.
What are the key properties of 2-amino-2-methyl-4-(2,2,2-trifluoroethoxy)pentanenitrile?
2-amino-2-methyl-4-(2,2,2-trifluoroethoxy)pentanenitrile has a molecular weight of 210.20 g/mol, XLogP of 1.58, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-methyl-4-(2,2,2-trifluoroethoxy)pentanenitrile is sourced from PubChem (CID 64728179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).