About 8-[(3,5-dimethylcyclohexyl)oxymethyl]-4H-1,3-benzodioxin-6-amine
8-[(3,5-dimethylcyclohexyl)oxymethyl]-4H-1,3-benzodioxin-6-amine (PubChem CID 64728367) has the molecular formula C17H25NO3
and a molecular weight of 291.39 g/mol. Its IUPAC name is 8-[(3,5-dimethylcyclohexyl)oxymethyl]-4H-1,3-benzodioxin-6-amine.
Molecular Properties
| Compound Name | 8-[(3,5-dimethylcyclohexyl)oxymethyl]-4H-1,3-benzodioxin-6-amine |
| PubChem CID | 64728367 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 8-[(3,5-dimethylcyclohexyl)oxymethyl]-4H-1,3-benzodioxin-6-amine |
| SMILES | CC1CC(C)CC(OCc2cc(N)cc3c2OCOC3)C1 |
| InChI | InChI=1S/C17H25NO3/c1-11-3-12(2)5-16(4-11)20-9-14-7-15(18)6-13-8-19-10-21-17(13)14/h6-7,11-12,16H,3-5,8-10,18H2,1-2H3 |
| InChIKey | QHURMLYMBSJGDR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 8-[(3,5-dimethylcyclohexyl)oxymethyl]-4H-1,3-benzodioxin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(3,5-dimethylcyclohexyl)oxymethyl]-4H-1,3-benzodioxin-6-amine?
The IUPAC name of 8-[(3,5-dimethylcyclohexyl)oxymethyl]-4H-1,3-benzodioxin-6-amine (CID 64728367) is 8-[(3,5-dimethylcyclohexyl)oxymethyl]-4H-1,3-benzodioxin-6-amine.
What is the SMILES notation for 8-[(3,5-dimethylcyclohexyl)oxymethyl]-4H-1,3-benzodioxin-6-amine?
The canonical SMILES for 8-[(3,5-dimethylcyclohexyl)oxymethyl]-4H-1,3-benzodioxin-6-amine is CC1CC(C)CC(OCc2cc(N)cc3c2OCOC3)C1.
What is the InChIKey of 8-[(3,5-dimethylcyclohexyl)oxymethyl]-4H-1,3-benzodioxin-6-amine?
The InChIKey is QHURMLYMBSJGDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO3/c1-11-3-12(2)5-16(4-11)20-9-14-7-15(18)6-13-8-19-10-21-17(13)14/h6-7,11-12,16H,3-5,8-10,18H2,1-2H3.
What are the key properties of 8-[(3,5-dimethylcyclohexyl)oxymethyl]-4H-1,3-benzodioxin-6-amine?
8-[(3,5-dimethylcyclohexyl)oxymethyl]-4H-1,3-benzodioxin-6-amine has a molecular weight of 291.39 g/mol, XLogP of 3.48, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(3,5-dimethylcyclohexyl)oxymethyl]-4H-1,3-benzodioxin-6-amine is sourced from PubChem (CID 64728367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).