C17H24O3 — CID 64728813
2-(3,5-dimethylcyclohexyl)oxy-1-(3-methoxyphenyl)ethanone (PubChem CID 64728813) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-(3,5-dimethylcyclohexyl)oxy-1-(3-methoxyphenyl)ethanone.
| Compound Name | 2-(3,5-dimethylcyclohexyl)oxy-1-(3-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 64728813 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 2-(3,5-dimethylcyclohexyl)oxy-1-(3-methoxyphenyl)ethanone |
| SMILES | COc1cccc(C(=O)COC2CC(C)CC(C)C2)c1 |
| InChI | InChI=1S/C17H24O3/c1-12-7-13(2)9-16(8-12)20-11-17(18)14-5-4-6-15(10-14)19-3/h4-6,10,12-13,16H,7-9,11H2,1-3H3 |
| InChIKey | NMYFYQMLZZIYEH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |