About 1-(2-chloroethyl)-3,5-dimethylcyclohexane
1-(2-chloroethyl)-3,5-dimethylcyclohexane (PubChem CID 64728937) has the molecular formula C10H19Cl
and a molecular weight of 174.71 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3,5-dimethylcyclohexane.
Molecular Properties
| Compound Name | 1-(2-chloroethyl)-3,5-dimethylcyclohexane |
| PubChem CID | 64728937 |
| Molecular Formula | C10H19Cl |
| Molecular Weight | 174.71 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 1-(2-chloroethyl)-3,5-dimethylcyclohexane |
| SMILES | CC1CC(C)CC(CCCl)C1 |
| InChI | InChI=1S/C10H19Cl/c1-8-5-9(2)7-10(6-8)3-4-11/h8-10H,3-7H2,1-2H3 |
| InChIKey | OLLYUSFVDOKLGL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.71 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-chloroethyl)-3,5-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chloroethyl)-3,5-dimethylcyclohexane?
The IUPAC name of 1-(2-chloroethyl)-3,5-dimethylcyclohexane (CID 64728937) is 1-(2-chloroethyl)-3,5-dimethylcyclohexane.
What is the SMILES notation for 1-(2-chloroethyl)-3,5-dimethylcyclohexane?
The canonical SMILES for 1-(2-chloroethyl)-3,5-dimethylcyclohexane is CC1CC(C)CC(CCCl)C1.
What is the InChIKey of 1-(2-chloroethyl)-3,5-dimethylcyclohexane?
The InChIKey is OLLYUSFVDOKLGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19Cl/c1-8-5-9(2)7-10(6-8)3-4-11/h8-10H,3-7H2,1-2H3.
What are the key properties of 1-(2-chloroethyl)-3,5-dimethylcyclohexane?
1-(2-chloroethyl)-3,5-dimethylcyclohexane has a molecular weight of 174.71 g/mol, XLogP of 3.69, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloroethyl)-3,5-dimethylcyclohexane is sourced from PubChem (CID 64728937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).