About 1-(4-chloro-2-methylpentan-2-yl)-3,5-dimethylcyclohexane
1-(4-chloro-2-methylpentan-2-yl)-3,5-dimethylcyclohexane (PubChem CID 64728956) has the molecular formula C14H27Cl
and a molecular weight of 230.82 g/mol. Its IUPAC name is 1-(4-chloro-2-methylpentan-2-yl)-3,5-dimethylcyclohexane.
Molecular Properties
| Compound Name | 1-(4-chloro-2-methylpentan-2-yl)-3,5-dimethylcyclohexane |
| PubChem CID | 64728956 |
| Molecular Formula | C14H27Cl |
| Molecular Weight | 230.82 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 1-(4-chloro-2-methylpentan-2-yl)-3,5-dimethylcyclohexane |
| SMILES | CC(Cl)CC(C)(C)C1CC(C)CC(C)C1 |
| InChI | InChI=1S/C14H27Cl/c1-10-6-11(2)8-13(7-10)14(4,5)9-12(3)15/h10-13H,6-9H2,1-5H3 |
| InChIKey | GPKAWBCOHJBBII-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 230.82 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-chloro-2-methylpentan-2-yl)-3,5-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chloro-2-methylpentan-2-yl)-3,5-dimethylcyclohexane?
The IUPAC name of 1-(4-chloro-2-methylpentan-2-yl)-3,5-dimethylcyclohexane (CID 64728956) is 1-(4-chloro-2-methylpentan-2-yl)-3,5-dimethylcyclohexane.
What is the SMILES notation for 1-(4-chloro-2-methylpentan-2-yl)-3,5-dimethylcyclohexane?
The canonical SMILES for 1-(4-chloro-2-methylpentan-2-yl)-3,5-dimethylcyclohexane is CC(Cl)CC(C)(C)C1CC(C)CC(C)C1.
What is the InChIKey of 1-(4-chloro-2-methylpentan-2-yl)-3,5-dimethylcyclohexane?
The InChIKey is GPKAWBCOHJBBII-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27Cl/c1-10-6-11(2)8-13(7-10)14(4,5)9-12(3)15/h10-13H,6-9H2,1-5H3.
What are the key properties of 1-(4-chloro-2-methylpentan-2-yl)-3,5-dimethylcyclohexane?
1-(4-chloro-2-methylpentan-2-yl)-3,5-dimethylcyclohexane has a molecular weight of 230.82 g/mol, XLogP of 5.10, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chloro-2-methylpentan-2-yl)-3,5-dimethylcyclohexane is sourced from PubChem (CID 64728956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).