About 4-(2,4-difluorophenoxy)butanoic acid
4-(2,4-difluorophenoxy)butanoic acid (PubChem CID 6472956) has the molecular formula C10H10F2O3
and a molecular weight of 216.18 g/mol. Its IUPAC name is 4-(2,4-difluorophenoxy)butanoic acid.
Molecular Properties
| Compound Name | 4-(2,4-difluorophenoxy)butanoic acid |
| PubChem CID | 6472956 |
| Molecular Formula | C10H10F2O3 |
| Molecular Weight | 216.18 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 4-(2,4-difluorophenoxy)butanoic acid |
| SMILES | O=C(O)CCCOc1ccc(F)cc1F |
| InChI | InChI=1S/C10H10F2O3/c11-7-3-4-9(8(12)6-7)15-5-1-2-10(13)14/h3-4,6H,1-2,5H2,(H,13,14) |
| InChIKey | AHUNOOHLCXZVML-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.18 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,4-difluorophenoxy)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-difluorophenoxy)butanoic acid?
The IUPAC name of 4-(2,4-difluorophenoxy)butanoic acid (CID 6472956) is 4-(2,4-difluorophenoxy)butanoic acid.
What is the SMILES notation for 4-(2,4-difluorophenoxy)butanoic acid?
The canonical SMILES for 4-(2,4-difluorophenoxy)butanoic acid is O=C(O)CCCOc1ccc(F)cc1F.
What is the InChIKey of 4-(2,4-difluorophenoxy)butanoic acid?
The InChIKey is AHUNOOHLCXZVML-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F2O3/c11-7-3-4-9(8(12)6-7)15-5-1-2-10(13)14/h3-4,6H,1-2,5H2,(H,13,14).
What are the key properties of 4-(2,4-difluorophenoxy)butanoic acid?
4-(2,4-difluorophenoxy)butanoic acid has a molecular weight of 216.18 g/mol, XLogP of 2.21, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-difluorophenoxy)butanoic acid is sourced from PubChem (CID 6472956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).