About 2-(3,5-dimethylcyclohexyl)-1,3-dihydroinden-2-amine
2-(3,5-dimethylcyclohexyl)-1,3-dihydroinden-2-amine (PubChem CID 64729680) has the molecular formula C17H25N
and a molecular weight of 243.39 g/mol. Its IUPAC name is 2-(3,5-dimethylcyclohexyl)-1,3-dihydroinden-2-amine.
Molecular Properties
| Compound Name | 2-(3,5-dimethylcyclohexyl)-1,3-dihydroinden-2-amine |
| PubChem CID | 64729680 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 2-(3,5-dimethylcyclohexyl)-1,3-dihydroinden-2-amine |
| SMILES | CC1CC(C)CC(C2(N)Cc3ccccc3C2)C1 |
| InChI | InChI=1S/C17H25N/c1-12-7-13(2)9-16(8-12)17(18)10-14-5-3-4-6-15(14)11-17/h3-6,12-13,16H,7-11,18H2,1-2H3 |
| InChIKey | SEEZEHLFAQLTCJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(3,5-dimethylcyclohexyl)-1,3-dihydroinden-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethylcyclohexyl)-1,3-dihydroinden-2-amine?
The IUPAC name of 2-(3,5-dimethylcyclohexyl)-1,3-dihydroinden-2-amine (CID 64729680) is 2-(3,5-dimethylcyclohexyl)-1,3-dihydroinden-2-amine.
What is the SMILES notation for 2-(3,5-dimethylcyclohexyl)-1,3-dihydroinden-2-amine?
The canonical SMILES for 2-(3,5-dimethylcyclohexyl)-1,3-dihydroinden-2-amine is CC1CC(C)CC(C2(N)Cc3ccccc3C2)C1.
What is the InChIKey of 2-(3,5-dimethylcyclohexyl)-1,3-dihydroinden-2-amine?
The InChIKey is SEEZEHLFAQLTCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N/c1-12-7-13(2)9-16(8-12)17(18)10-14-5-3-4-6-15(14)11-17/h3-6,12-13,16H,7-11,18H2,1-2H3.
What are the key properties of 2-(3,5-dimethylcyclohexyl)-1,3-dihydroinden-2-amine?
2-(3,5-dimethylcyclohexyl)-1,3-dihydroinden-2-amine has a molecular weight of 243.39 g/mol, XLogP of 3.56, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethylcyclohexyl)-1,3-dihydroinden-2-amine is sourced from PubChem (CID 64729680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).